C18H23NO2 — CID 124627955
3-[(1S)-1-[[(2R,3R)-3-hydroxy-4-phenylbutan-2-yl]amino]ethyl]phenol (PubChem CID 124627955) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-[(1S)-1-[[(2R,3R)-3-hydroxy-4-phenylbutan-2-yl]amino]ethyl]phenol.
| Compound Name | 3-[(1S)-1-[[(2R,3R)-3-hydroxy-4-phenylbutan-2-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 124627955 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 3-[(1S)-1-[[(2R,3R)-3-hydroxy-4-phenylbutan-2-yl]amino]ethyl]phenol |
| SMILES | C[C@H](N[C@H](C)[C@H](O)Cc1ccccc1)c1cccc(O)c1 |
| InChI | InChI=1S/C18H23NO2/c1-13(16-9-6-10-17(20)12-16)19-14(2)18(21)11-15-7-4-3-5-8-15/h3-10,12-14,18-21H,11H2,1-2H3/t13-,14+,18+/m0/s1 |
| InChIKey | IMYHOPSJDGRZRY-PMUMKWKESA-N |
| XLogP | 3.03 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |