About bis[[(2R)-oxolan-2-yl]methyl] [(2S)-oxolan-2-yl]methyl borate
bis[[(2R)-oxolan-2-yl]methyl] [(2S)-oxolan-2-yl]methyl borate (PubChem CID 124629023) has the molecular formula C15H27BO6
and a molecular weight of 314.19 g/mol. Its IUPAC name is bis[[(2R)-oxolan-2-yl]methyl] [(2S)-oxolan-2-yl]methyl borate.
Molecular Properties
| Compound Name | bis[[(2R)-oxolan-2-yl]methyl] [(2S)-oxolan-2-yl]methyl borate |
| PubChem CID | 124629023 |
| Molecular Formula | C15H27BO6 |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | bis[[(2R)-oxolan-2-yl]methyl] [(2S)-oxolan-2-yl]methyl borate |
| SMILES | C1CO[C@@H](COB(OC[C@H]2CCCO2)OC[C@@H]2CCCO2)C1 |
| InChI | InChI=1S/C15H27BO6/c1-4-13(17-7-1)10-20-16(21-11-14-5-2-8-18-14)22-12-15-6-3-9-19-15/h13-15H,1-12H2/t13-,14-,15+/m1/s1 |
| InChIKey | MCTPAFAHCPKXRC-KFWWJZLASA-N |
| XLogP | 1.56 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis[[(2R)-oxolan-2-yl]methyl] [(2S)-oxolan-2-yl]methyl borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[[(2R)-oxolan-2-yl]methyl] [(2S)-oxolan-2-yl]methyl borate?
The IUPAC name of bis[[(2R)-oxolan-2-yl]methyl] [(2S)-oxolan-2-yl]methyl borate (CID 124629023) is bis[[(2R)-oxolan-2-yl]methyl] [(2S)-oxolan-2-yl]methyl borate.
What is the SMILES notation for bis[[(2R)-oxolan-2-yl]methyl] [(2S)-oxolan-2-yl]methyl borate?
The canonical SMILES for bis[[(2R)-oxolan-2-yl]methyl] [(2S)-oxolan-2-yl]methyl borate is C1CO[C@@H](COB(OC[C@H]2CCCO2)OC[C@@H]2CCCO2)C1.
What is the InChIKey of bis[[(2R)-oxolan-2-yl]methyl] [(2S)-oxolan-2-yl]methyl borate?
The InChIKey is MCTPAFAHCPKXRC-KFWWJZLASA-N. The full InChI is InChI=1S/C15H27BO6/c1-4-13(17-7-1)10-20-16(21-11-14-5-2-8-18-14)22-12-15-6-3-9-19-15/h13-15H,1-12H2/t13-,14-,15+/m1/s1.
What are the key properties of bis[[(2R)-oxolan-2-yl]methyl] [(2S)-oxolan-2-yl]methyl borate?
bis[[(2R)-oxolan-2-yl]methyl] [(2S)-oxolan-2-yl]methyl borate has a molecular weight of 314.19 g/mol, XLogP of 1.56, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis[[(2R)-oxolan-2-yl]methyl] [(2S)-oxolan-2-yl]methyl borate is sourced from PubChem (CID 124629023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).