C12H13BrF2O2 — CID 124634964
tert-butyl (2S)-2-bromo-2-(3,5-difluorophenyl)acetate (PubChem CID 124634964) has the molecular formula C12H13BrF2O2 and a molecular weight of 307.13 g/mol. Its IUPAC name is tert-butyl (2S)-2-bromo-2-(3,5-difluorophenyl)acetate.
| Compound Name | tert-butyl (2S)-2-bromo-2-(3,5-difluorophenyl)acetate |
|---|---|
| PubChem CID | 124634964 |
| Molecular Formula | C12H13BrF2O2 |
| Molecular Weight | 307.13 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | tert-butyl (2S)-2-bromo-2-(3,5-difluorophenyl)acetate |
| SMILES | CC(C)(C)OC(=O)[C@@H](Br)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H13BrF2O2/c1-12(2,3)17-11(16)10(13)7-4-8(14)6-9(15)5-7/h4-6,10H,1-3H3/t10-/m0/s1 |
| InChIKey | JJPTYJNVOXXHDM-JTQLQIEISA-N |
| XLogP | 3.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.13 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|