C12H26Si — CID 124635131
dimethyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]silane (PubChem CID 124635131) has the molecular formula C12H26Si and a molecular weight of 198.43 g/mol. Its IUPAC name is dimethyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]silane.
| Compound Name | dimethyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]silane |
|---|---|
| PubChem CID | 124635131 |
| Molecular Formula | C12H26Si |
| Molecular Weight | 198.43 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | dimethyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]silane |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1[SiH](C)C |
| InChI | InChI=1S/C12H26Si/c1-9(2)11-7-6-10(3)8-12(11)13(4)5/h9-13H,6-8H2,1-5H3/t10-,11+,12-/m1/s1 |
| InChIKey | AFIJTAAKGYQYDN-GRYCIOLGSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|