C10H15NO3 — CID 124636672
methyl (3aS,7aR)-7-oxo-3,3a,4,5,6,7a-hexahydro-2H-indole-1-carboxylate (PubChem CID 124636672) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is methyl (3aS,7aR)-7-oxo-3,3a,4,5,6,7a-hexahydro-2H-indole-1-carboxylate.
| Compound Name | methyl (3aS,7aR)-7-oxo-3,3a,4,5,6,7a-hexahydro-2H-indole-1-carboxylate |
|---|---|
| PubChem CID | 124636672 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | methyl (3aS,7aR)-7-oxo-3,3a,4,5,6,7a-hexahydro-2H-indole-1-carboxylate |
| SMILES | COC(=O)N1CC[C@@H]2CCCC(=O)[C@@H]21 |
| InChI | InChI=1S/C10H15NO3/c1-14-10(13)11-6-5-7-3-2-4-8(12)9(7)11/h7,9H,2-6H2,1H3/t7-,9+/m0/s1 |
| InChIKey | HAYZAKFROTUBGS-IONNQARKSA-N |
| XLogP | 1.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |