C16H17NO — CID 124637234
(3R)-4,6-dimethyl-3-phenyl-2,3-dihydro-1-benzofuran-5-amine (PubChem CID 124637234) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is (3R)-4,6-dimethyl-3-phenyl-2,3-dihydro-1-benzofuran-5-amine.
| Compound Name | (3R)-4,6-dimethyl-3-phenyl-2,3-dihydro-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 124637234 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (3R)-4,6-dimethyl-3-phenyl-2,3-dihydro-1-benzofuran-5-amine |
| SMILES | Cc1cc2c(c(C)c1N)[C@@H](c1ccccc1)CO2 |
| InChI | InChI=1S/C16H17NO/c1-10-8-14-15(11(2)16(10)17)13(9-18-14)12-6-4-3-5-7-12/h3-8,13H,9,17H2,1-2H3/t13-/m1/s1 |
| InChIKey | WZEGWLOSWITYOL-CYBMUJFWSA-N |
| XLogP | 3.41 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|