C11H19NO2 — CID 124637713
ethyl (1S,5R)-5-aminobicyclo[3.2.1]octane-1-carboxylate (PubChem CID 124637713) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is ethyl (1S,5R)-5-aminobicyclo[3.2.1]octane-1-carboxylate.
| Compound Name | ethyl (1S,5R)-5-aminobicyclo[3.2.1]octane-1-carboxylate |
|---|---|
| PubChem CID | 124637713 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | ethyl (1S,5R)-5-aminobicyclo[3.2.1]octane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]12CCC[C@@](N)(CC1)C2 |
| InChI | InChI=1S/C11H19NO2/c1-2-14-9(13)10-4-3-5-11(12,8-10)7-6-10/h2-8,12H2,1H3/t10-,11+/m0/s1 |
| InChIKey | TVLKCBWKNZEGNL-WDEREUQCSA-N |
| XLogP | 1.60 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |