C14H24N2O2 — CID 124639737
(1S,2S)-1-amino-3-[3-[(2R,3S)-3-amino-3-hydroxy-2-methylpropyl]phenyl]-2-methylpropan-1-ol (PubChem CID 124639737) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is (1S,2S)-1-amino-3-[3-[(2R,3S)-3-amino-3-hydroxy-2-methylpropyl]phenyl]-2-methylpropan-1-ol.
| Compound Name | (1S,2S)-1-amino-3-[3-[(2R,3S)-3-amino-3-hydroxy-2-methylpropyl]phenyl]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 124639737 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | (1S,2S)-1-amino-3-[3-[(2R,3S)-3-amino-3-hydroxy-2-methylpropyl]phenyl]-2-methylpropan-1-ol |
| SMILES | C[C@H](Cc1cccc(C[C@H](C)[C@@H](N)O)c1)[C@@H](N)O |
| InChI | InChI=1S/C14H24N2O2/c1-9(13(15)17)6-11-4-3-5-12(8-11)7-10(2)14(16)18/h3-5,8-10,13-14,17-18H,6-7,15-16H2,1-2H3/t9-,10+,13-,14-/m0/s1 |
| InChIKey | NJRYEIYTVKCLGF-DJBIQUGXSA-N |
| XLogP | 0.60 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|