C29H26ClFN2O5S — CID 124640764
2-[4-[(E)-[3-[(2-chloro-6-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]-N-(3,4-dimethylphenyl)acetamide (PubChem CID 124640764) has the molecular formula C29H26ClFN2O5S and a molecular weight of 569.05 g/mol. Its IUPAC name is 2-[4-[(E)-[3-[(2-chloro-6-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]-N-(3,4-dimethylphenyl)acetamide.
| Compound Name | 2-[4-[(E)-[3-[(2-chloro-6-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]-N-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 124640764 |
| Molecular Formula | C29H26ClFN2O5S |
| Molecular Weight | 569.05 g/mol |
| Exact Mass | 568.12 |
| IUPAC Name | 2-[4-[(E)-[3-[(2-chloro-6-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]-N-(3,4-dimethylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(Cc3c(F)cccc3Cl)C2=O)ccc1OCC(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C29H26ClFN2O5S/c1-4-37-25-13-19(9-11-24(25)38-16-27(34)32-20-10-8-17(2)18(3)12-20)14-26-28(35)33(29(36)39-26)15-21-22(30)6-5-7-23(21)31/h5-14H,4,15-16H2,1-3H3,(H,32,34)/b26-14+ |
| InChIKey | ULTXFLVPQRIPKQ-VULFUBBASA-N |
| XLogP | 6.75 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.05 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|