C12H15N5 — CID 124641222
2-(1H-imidazol-2-yl)-6-[(3R)-piperidin-3-yl]pyrazine (PubChem CID 124641222) has the molecular formula C12H15N5 and a molecular weight of 229.29 g/mol. Its IUPAC name is 2-(1H-imidazol-2-yl)-6-[(3R)-piperidin-3-yl]pyrazine.
| Compound Name | 2-(1H-imidazol-2-yl)-6-[(3R)-piperidin-3-yl]pyrazine |
|---|---|
| PubChem CID | 124641222 |
| Molecular Formula | C12H15N5 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 2-(1H-imidazol-2-yl)-6-[(3R)-piperidin-3-yl]pyrazine |
| SMILES | c1c[nH]c(-c2cncc([C@@H]3CCCNC3)n2)n1 |
| InChI | InChI=1S/C12H15N5/c1-2-9(6-13-3-1)10-7-14-8-11(17-10)12-15-4-5-16-12/h4-5,7-9,13H,1-3,6H2,(H,15,16)/t9-/m1/s1 |
| InChIKey | OUTUFPDZFPEORX-SECBINFHSA-N |
| XLogP | 1.33 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |