C15H19N5 — CID 125024879
N-(3-methyl-2-pyridinyl)-6-[(3S)-piperidin-3-yl]pyrazin-2-amine (PubChem CID 125024879) has the molecular formula C15H19N5 and a molecular weight of 269.35 g/mol. Its IUPAC name is N-(3-methyl-2-pyridinyl)-6-[(3S)-piperidin-3-yl]pyrazin-2-amine.
| Compound Name | N-(3-methyl-2-pyridinyl)-6-[(3S)-piperidin-3-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 125024879 |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | N-(3-methyl-2-pyridinyl)-6-[(3S)-piperidin-3-yl]pyrazin-2-amine |
| SMILES | Cc1cccnc1Nc1cncc([C@H]2CCCNC2)n1 |
| InChI | InChI=1S/C15H19N5/c1-11-4-2-7-18-15(11)20-14-10-17-9-13(19-14)12-5-3-6-16-8-12/h2,4,7,9-10,12,16H,3,5-6,8H2,1H3,(H,18,19,20)/t12-/m0/s1 |
| InChIKey | ZIOYMNLPVZDOKO-LBPRGKRZSA-N |
| XLogP | 2.39 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |