C14H17N5 — CID 125009516
N-[6-[(3R)-piperidin-3-yl]-2-pyridinyl]pyrimidin-2-amine (PubChem CID 125009516) has the molecular formula C14H17N5 and a molecular weight of 255.33 g/mol. Its IUPAC name is N-[6-[(3R)-piperidin-3-yl]-2-pyridinyl]pyrimidin-2-amine.
| Compound Name | N-[6-[(3R)-piperidin-3-yl]-2-pyridinyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 125009516 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | N-[6-[(3R)-piperidin-3-yl]-2-pyridinyl]pyrimidin-2-amine |
| SMILES | c1cnc(Nc2cccc([C@@H]3CCCNC3)n2)nc1 |
| InChI | InChI=1S/C14H17N5/c1-5-12(11-4-2-7-15-10-11)18-13(6-1)19-14-16-8-3-9-17-14/h1,3,5-6,8-9,11,15H,2,4,7,10H2,(H,16,17,18,19)/t11-/m1/s1 |
| InChIKey | VCUCFGDZHLZTOG-LLVKDONJSA-N |
| XLogP | 2.08 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |