C13H16N6 — CID 175661062
3-piperidin-3-yl-N-pyrimidin-2-ylpyrazin-2-amine (PubChem CID 175661062) has the molecular formula C13H16N6 and a molecular weight of 256.31 g/mol. Its IUPAC name is 3-piperidin-3-yl-N-pyrimidin-2-ylpyrazin-2-amine.
| Compound Name | 3-piperidin-3-yl-N-pyrimidin-2-ylpyrazin-2-amine |
|---|---|
| PubChem CID | 175661062 |
| Molecular Formula | C13H16N6 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 3-piperidin-3-yl-N-pyrimidin-2-ylpyrazin-2-amine |
| SMILES | c1cnc(Nc2nccnc2C2CCCNC2)nc1 |
| InChI | InChI=1S/C13H16N6/c1-3-10(9-14-4-1)11-12(16-8-7-15-11)19-13-17-5-2-6-18-13/h2,5-8,10,14H,1,3-4,9H2,(H,16,17,18,19) |
| InChIKey | GEFLOFPGJZTYHK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |