C15H16FN3 — CID 95816643
2-(2-fluorophenyl)-3-[(3R)-piperidin-3-yl]pyrazine (PubChem CID 95816643) has the molecular formula C15H16FN3 and a molecular weight of 257.31 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-3-[(3R)-piperidin-3-yl]pyrazine.
| Compound Name | 2-(2-fluorophenyl)-3-[(3R)-piperidin-3-yl]pyrazine |
|---|---|
| PubChem CID | 95816643 |
| Molecular Formula | C15H16FN3 |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 2-(2-fluorophenyl)-3-[(3R)-piperidin-3-yl]pyrazine |
| SMILES | Fc1ccccc1-c1nccnc1[C@@H]1CCCNC1 |
| InChI | InChI=1S/C15H16FN3/c16-13-6-2-1-5-12(13)15-14(18-8-9-19-15)11-4-3-7-17-10-11/h1-2,5-6,8-9,11,17H,3-4,7,10H2/t11-/m1/s1 |
| InChIKey | QIXLLKSSAVKBMW-LLVKDONJSA-N |
| XLogP | 2.75 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |