C24H22BrN3O7S — CID 124643509
(5E)-5-[[2-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 124643509) has the molecular formula C24H22BrN3O7S and a molecular weight of 576.43 g/mol. Its IUPAC name is (5E)-5-[[2-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[2-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124643509 |
| Molecular Formula | C24H22BrN3O7S |
| Molecular Weight | 576.43 g/mol |
| Exact Mass | 575.04 |
| IUPAC Name | (5E)-5-[[2-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2/SC(=O)N(CC(=O)N3CCCC3)C2=O)c(Br)cc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H22BrN3O7S/c1-34-19-10-16(18(25)12-20(19)35-14-15-4-6-17(7-5-15)28(32)33)11-21-23(30)27(24(31)36-21)13-22(29)26-8-2-3-9-26/h4-7,10-12H,2-3,8-9,13-14H2,1H3/b21-11+ |
| InChIKey | WJYWBIVNXGXEQM-SRZZPIQSSA-N |
| XLogP | 4.60 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|