C27H29BrN2O5S — CID 4013092
3-[2-(azepan-1-yl)-2-oxoethyl]-5-[[2-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 4013092) has the molecular formula C27H29BrN2O5S and a molecular weight of 573.51 g/mol. Its IUPAC name is 3-[2-(azepan-1-yl)-2-oxoethyl]-5-[[2-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[2-(azepan-1-yl)-2-oxoethyl]-5-[[2-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 4013092 |
| Molecular Formula | C27H29BrN2O5S |
| Molecular Weight | 573.51 g/mol |
| Exact Mass | 572.10 |
| IUPAC Name | 3-[2-(azepan-1-yl)-2-oxoethyl]-5-[[2-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(C=C2SC(=O)N(CC(=O)N3CCCCCC3)C2=O)c(Br)cc1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C27H29BrN2O5S/c1-18-7-9-19(10-8-18)17-35-23-15-21(28)20(13-22(23)34-2)14-24-26(32)30(27(33)36-24)16-25(31)29-11-5-3-4-6-12-29/h7-10,13-15H,3-6,11-12,16-17H2,1-2H3 |
| InChIKey | YCADAEFEPHDTII-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|