C27H27BrFN3O6S — CID 4553973
2-[4-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-5-bromo-2-methoxyphenoxy]-N-(4-fluorophenyl)acetamide (PubChem CID 4553973) has the molecular formula C27H27BrFN3O6S and a molecular weight of 620.50 g/mol. Its IUPAC name is 2-[4-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-5-bromo-2-methoxyphenoxy]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[4-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-5-bromo-2-methoxyphenoxy]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 4553973 |
| Molecular Formula | C27H27BrFN3O6S |
| Molecular Weight | 620.50 g/mol |
| Exact Mass | 619.08 |
| IUPAC Name | 2-[4-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-5-bromo-2-methoxyphenoxy]-N-(4-fluorophenyl)acetamide |
| SMILES | COc1cc(C=C2SC(=O)N(CC(=O)N3CCCCCC3)C2=O)c(Br)cc1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C27H27BrFN3O6S/c1-37-21-12-17(20(28)14-22(21)38-16-24(33)30-19-8-6-18(29)7-9-19)13-23-26(35)32(27(36)39-23)15-25(34)31-10-4-2-3-5-11-31/h6-9,12-14H,2-5,10-11,15-16H2,1H3,(H,30,33) |
| InChIKey | BTPGZLPBPLAWKM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.50 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|