C11H11FO3 — CID 124644295
methyl (E,4S)-4-(2-fluorophenyl)-4-hydroxybut-2-enoate (PubChem CID 124644295) has the molecular formula C11H11FO3 and a molecular weight of 210.20 g/mol. Its IUPAC name is methyl (E,4S)-4-(2-fluorophenyl)-4-hydroxybut-2-enoate.
| Compound Name | methyl (E,4S)-4-(2-fluorophenyl)-4-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 124644295 |
| Molecular Formula | C11H11FO3 |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | methyl (E,4S)-4-(2-fluorophenyl)-4-hydroxybut-2-enoate |
| SMILES | COC(=O)/C=C/[C@H](O)c1ccccc1F |
| InChI | InChI=1S/C11H11FO3/c1-15-11(14)7-6-10(13)8-4-2-3-5-9(8)12/h2-7,10,13H,1H3/b7-6+/t10-/m0/s1 |
| InChIKey | NJOCLXSOMTYZKP-FGEFZZPRSA-N |
| XLogP | 1.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|