C25H20N2O7 — CID 124647192
3-[(1R,3aR,6aS)-5-(4-acetylphenyl)-1',3',4,6-tetraoxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,2'-indene]-1-yl]propanoic acid (PubChem CID 124647192) has the molecular formula C25H20N2O7 and a molecular weight of 460.44 g/mol. Its IUPAC name is 3-[(1R,3aR,6aS)-5-(4-acetylphenyl)-1',3',4,6-tetraoxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,2'-indene]-1-yl]propanoic acid.
| Compound Name | 3-[(1R,3aR,6aS)-5-(4-acetylphenyl)-1',3',4,6-tetraoxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,2'-indene]-1-yl]propanoic acid |
|---|---|
| PubChem CID | 124647192 |
| Molecular Formula | C25H20N2O7 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 3-[(1R,3aR,6aS)-5-(4-acetylphenyl)-1',3',4,6-tetraoxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,2'-indene]-1-yl]propanoic acid |
| SMILES | CC(=O)c1ccc(N2C(=O)[C@H]3[C@@H](C2=O)C2(N[C@@H]3CCC(=O)O)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C25H20N2O7/c1-12(28)13-6-8-14(9-7-13)27-23(33)19-17(10-11-18(29)30)26-25(20(19)24(27)34)21(31)15-4-2-3-5-16(15)22(25)32/h2-9,17,19-20,26H,10-11H2,1H3,(H,29,30)/t17-,19-,20+/m1/s1 |
| InChIKey | QEKFYMXPIINLFR-RLLQIKCJSA-N |
| XLogP | 1.65 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|