C18H16N2O4S — CID 124650120
4-[2-[(E)-(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]pyrrol-1-yl]benzoic acid (PubChem CID 124650120) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is 4-[2-[(E)-(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]pyrrol-1-yl]benzoic acid.
| Compound Name | 4-[2-[(E)-(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]pyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 124650120 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 4-[2-[(E)-(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]pyrrol-1-yl]benzoic acid |
| SMILES | CC(C)N1C(=O)S/C(=C/c2cccn2-c2ccc(C(=O)O)cc2)C1=O |
| InChI | InChI=1S/C18H16N2O4S/c1-11(2)20-16(21)15(25-18(20)24)10-14-4-3-9-19(14)13-7-5-12(6-8-13)17(22)23/h3-11H,1-2H3,(H,22,23)/b15-10+ |
| InChIKey | JEGHAYVGCWNPBG-XNTDXEJSSA-N |
| XLogP | 3.62 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|