C27H35N3O4S — CID 124651562
6,7-dimethoxy-N-[(2R)-4-methylsulfanyl-1-oxo-1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butan-2-yl]-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 124651562) has the molecular formula C27H35N3O4S and a molecular weight of 497.66 g/mol. Its IUPAC name is 6,7-dimethoxy-N-[(2R)-4-methylsulfanyl-1-oxo-1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butan-2-yl]-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | 6,7-dimethoxy-N-[(2R)-4-methylsulfanyl-1-oxo-1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butan-2-yl]-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 124651562 |
| Molecular Formula | C27H35N3O4S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | 6,7-dimethoxy-N-[(2R)-4-methylsulfanyl-1-oxo-1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butan-2-yl]-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)N[C@H](CCSC)C(=O)N[C@@H]1CCCc3ccccc31)CC2 |
| InChI | InChI=1S/C27H35N3O4S/c1-33-24-15-19-11-13-30(17-20(19)16-25(24)34-2)27(32)29-23(12-14-35-3)26(31)28-22-10-6-8-18-7-4-5-9-21(18)22/h4-5,7,9,15-16,22-23H,6,8,10-14,17H2,1-3H3,(H,28,31)(H,29,32)/t22-,23-/m1/s1 |
| InChIKey | PKIKNWRPYIGDSH-DHIUTWEWSA-N |
| XLogP | 4.09 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |