C21H20ClNO4S — CID 124653534
(5E)-5-[(4-butoxy-3-methoxyphenyl)methylidene]-3-(3-chlorophenyl)-1,3-thiazolidine-2,4-dione (PubChem CID 124653534) has the molecular formula C21H20ClNO4S and a molecular weight of 417.91 g/mol. Its IUPAC name is (5E)-5-[(4-butoxy-3-methoxyphenyl)methylidene]-3-(3-chlorophenyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(4-butoxy-3-methoxyphenyl)methylidene]-3-(3-chlorophenyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124653534 |
| Molecular Formula | C21H20ClNO4S |
| Molecular Weight | 417.91 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | (5E)-5-[(4-butoxy-3-methoxyphenyl)methylidene]-3-(3-chlorophenyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CCCCOc1ccc(/C=C2/SC(=O)N(c3cccc(Cl)c3)C2=O)cc1OC |
| InChI | InChI=1S/C21H20ClNO4S/c1-3-4-10-27-17-9-8-14(11-18(17)26-2)12-19-20(24)23(21(25)28-19)16-7-5-6-15(22)13-16/h5-9,11-13H,3-4,10H2,1-2H3/b19-12+ |
| InChIKey | YUWRUAJZFACYFS-XDHOZWIPSA-N |
| XLogP | 5.77 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.91 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|