C23H25NO6S — CID 18840062
(5Z)-5-[(4-butoxy-3-methoxyphenyl)methylidene]-3-(2,4-dimethoxyphenyl)-1,3-thiazolidine-2,4-dione (PubChem CID 18840062) has the molecular formula C23H25NO6S and a molecular weight of 443.52 g/mol. Its IUPAC name is (5Z)-5-[(4-butoxy-3-methoxyphenyl)methylidene]-3-(2,4-dimethoxyphenyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(4-butoxy-3-methoxyphenyl)methylidene]-3-(2,4-dimethoxyphenyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 18840062 |
| Molecular Formula | C23H25NO6S |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | (5Z)-5-[(4-butoxy-3-methoxyphenyl)methylidene]-3-(2,4-dimethoxyphenyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CCCCOc1ccc(/C=C2\SC(=O)N(c3ccc(OC)cc3OC)C2=O)cc1OC |
| InChI | InChI=1S/C23H25NO6S/c1-5-6-11-30-18-10-7-15(12-20(18)29-4)13-21-22(25)24(23(26)31-21)17-9-8-16(27-2)14-19(17)28-3/h7-10,12-14H,5-6,11H2,1-4H3/b21-13- |
| InChIKey | RYIPHYMQHMICFY-BKUYFWCQSA-N |
| XLogP | 5.13 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|