C19H18N2O4S — CID 1246559
N-[3-[(2-ethoxyphenyl)carbamoyl]thiophen-2-yl]-2-methylfuran-3-carboxamide (PubChem CID 1246559) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is N-[3-[(2-ethoxyphenyl)carbamoyl]thiophen-2-yl]-2-methylfuran-3-carboxamide.
| Compound Name | N-[3-[(2-ethoxyphenyl)carbamoyl]thiophen-2-yl]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 1246559 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | N-[3-[(2-ethoxyphenyl)carbamoyl]thiophen-2-yl]-2-methylfuran-3-carboxamide |
| SMILES | CCOc1ccccc1NC(=O)c1ccsc1NC(=O)c1ccoc1C |
| InChI | InChI=1S/C19H18N2O4S/c1-3-24-16-7-5-4-6-15(16)20-18(23)14-9-11-26-19(14)21-17(22)13-8-10-25-12(13)2/h4-11H,3H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | VMDYFGHARPDCBX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |