C20H19ClN2O4S — CID 124658145
(E)-4-[4-[(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-2-methyl-4-oxobut-2-enoic acid (PubChem CID 124658145) has the molecular formula C20H19ClN2O4S and a molecular weight of 418.90 g/mol. Its IUPAC name is (E)-4-[4-[(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-2-methyl-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[4-[(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-2-methyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 124658145 |
| Molecular Formula | C20H19ClN2O4S |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | (E)-4-[4-[(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-2-methyl-4-oxobut-2-enoic acid |
| SMILES | C/C(=C\C(=O)Nc1ccc(S[C@H](C)C(=O)Nc2cccc(Cl)c2)cc1)C(=O)O |
| InChI | InChI=1S/C20H19ClN2O4S/c1-12(20(26)27)10-18(24)22-15-6-8-17(9-7-15)28-13(2)19(25)23-16-5-3-4-14(21)11-16/h3-11,13H,1-2H3,(H,22,24)(H,23,25)(H,26,27)/b12-10+/t13-/m1/s1 |
| InChIKey | AUVZEHZUSMARDI-RSKUSDAESA-N |
| XLogP | 4.43 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|