C23H21N3O4S — CID 93267079
(Z)-2-methyl-4-oxo-4-[4-[(2R)-1-oxo-1-(quinolin-3-ylamino)propan-2-yl]sulfanylanilino]but-2-enoic acid (PubChem CID 93267079) has the molecular formula C23H21N3O4S and a molecular weight of 435.51 g/mol. Its IUPAC name is (Z)-2-methyl-4-oxo-4-[4-[(2R)-1-oxo-1-(quinolin-3-ylamino)propan-2-yl]sulfanylanilino]but-2-enoic acid.
| Compound Name | (Z)-2-methyl-4-oxo-4-[4-[(2R)-1-oxo-1-(quinolin-3-ylamino)propan-2-yl]sulfanylanilino]but-2-enoic acid |
|---|---|
| PubChem CID | 93267079 |
| Molecular Formula | C23H21N3O4S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | (Z)-2-methyl-4-oxo-4-[4-[(2R)-1-oxo-1-(quinolin-3-ylamino)propan-2-yl]sulfanylanilino]but-2-enoic acid |
| SMILES | C/C(=C/C(=O)Nc1ccc(S[C@H](C)C(=O)Nc2cnc3ccccc3c2)cc1)C(=O)O |
| InChI | InChI=1S/C23H21N3O4S/c1-14(23(29)30)11-21(27)25-17-7-9-19(10-8-17)31-15(2)22(28)26-18-12-16-5-3-4-6-20(16)24-13-18/h3-13,15H,1-2H3,(H,25,27)(H,26,28)(H,29,30)/b14-11-/t15-/m1/s1 |
| InChIKey | DIFRKOSZUDAHTA-QKXCFHHRSA-N |
| XLogP | 4.32 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|