C12H19NO2 — CID 124670212
[(3S,5S)-4-amino-1-adamantyl] acetate (PubChem CID 124670212) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is [(3S,5S)-4-amino-1-adamantyl] acetate.
| Compound Name | [(3S,5S)-4-amino-1-adamantyl] acetate |
|---|---|
| PubChem CID | 124670212 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | [(3S,5S)-4-amino-1-adamantyl] acetate |
| SMILES | CC(=O)OC12CC3C[C@@H](C1)C(N)[C@@H](C3)C2 |
| InChI | InChI=1S/C12H19NO2/c1-7(14)15-12-4-8-2-9(5-12)11(13)10(3-8)6-12/h8-11H,2-6,13H2,1H3/t8?,9-,10-,11?,12?/m0/s1 |
| InChIKey | BRFGGSRWELOCLA-SJZSRGDHSA-N |
| XLogP | 1.46 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |