C11H10O3 — CID 124670632
(1aR,7bS)-3,7b-dihydro-2H-naphtho[1,2-b]oxirene-1a-carboxylic acid (PubChem CID 124670632) has the molecular formula C11H10O3 and a molecular weight of 190.20 g/mol. Its IUPAC name is (1aR,7bS)-3,7b-dihydro-2H-naphtho[1,2-b]oxirene-1a-carboxylic acid.
| Compound Name | (1aR,7bS)-3,7b-dihydro-2H-naphtho[1,2-b]oxirene-1a-carboxylic acid |
|---|---|
| PubChem CID | 124670632 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | (1aR,7bS)-3,7b-dihydro-2H-naphtho[1,2-b]oxirene-1a-carboxylic acid |
| SMILES | O=C(O)[C@@]12CCc3ccccc3[C@@H]1O2 |
| InChI | InChI=1S/C11H10O3/c12-10(13)11-6-5-7-3-1-2-4-8(7)9(11)14-11/h1-4,9H,5-6H2,(H,12,13)/t9-,11+/m0/s1 |
| InChIKey | GRJUFDNUVUTCGG-GXSJLCMTSA-N |
| XLogP | 1.53 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|