C24H19N3O7S — CID 124671166
ethyl (2Z,5R)-5-(1,3-benzodioxol-5-yl)-7-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 124671166) has the molecular formula C24H19N3O7S and a molecular weight of 493.50 g/mol. Its IUPAC name is ethyl (2Z,5R)-5-(1,3-benzodioxol-5-yl)-7-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2Z,5R)-5-(1,3-benzodioxol-5-yl)-7-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 124671166 |
| Molecular Formula | C24H19N3O7S |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | ethyl (2Z,5R)-5-(1,3-benzodioxol-5-yl)-7-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C\c3ccc([N+](=O)[O-])cc3)c(=O)n2[C@@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H19N3O7S/c1-3-32-23(29)20-13(2)25-24-26(21(20)15-6-9-17-18(11-15)34-12-33-17)22(28)19(35-24)10-14-4-7-16(8-5-14)27(30)31/h4-11,21H,3,12H2,1-2H3/b19-10-/t21-/m1/s1 |
| InChIKey | SQCXOBFMWQIEHY-BYHQVZLYSA-N |
| XLogP | 2.44 |
| TPSA | 122.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|