C28H21N3O8S — CID 2858812
ethyl 5-(1,3-benzodioxol-5-yl)-7-methyl-2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 2858812) has the molecular formula C28H21N3O8S and a molecular weight of 559.56 g/mol. Its IUPAC name is ethyl 5-(1,3-benzodioxol-5-yl)-7-methyl-2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 5-(1,3-benzodioxol-5-yl)-7-methyl-2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 2858812 |
| Molecular Formula | C28H21N3O8S |
| Molecular Weight | 559.56 g/mol |
| Exact Mass | 559.10 |
| IUPAC Name | ethyl 5-(1,3-benzodioxol-5-yl)-7-methyl-2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2sc(=Cc3ccc(-c4ccc([N+](=O)[O-])cc4)o3)c(=O)n2C1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C28H21N3O8S/c1-3-36-27(33)24-15(2)29-28-30(25(24)17-6-10-21-22(12-17)38-14-37-21)26(32)23(40-28)13-19-9-11-20(39-19)16-4-7-18(8-5-16)31(34)35/h4-13,25H,3,14H2,1-2H3 |
| InChIKey | PNINCPFIYKYRRV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 135.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|