C18H34O6Si2 — CID 124671488
trimethoxy-[(1S)-1-[3-[(1S)-1-trimethoxysilylpropyl]phenyl]propyl]silane (PubChem CID 124671488) has the molecular formula C18H34O6Si2 and a molecular weight of 402.64 g/mol. Its IUPAC name is trimethoxy-[(1S)-1-[3-[(1S)-1-trimethoxysilylpropyl]phenyl]propyl]silane.
| Compound Name | trimethoxy-[(1S)-1-[3-[(1S)-1-trimethoxysilylpropyl]phenyl]propyl]silane |
|---|---|
| PubChem CID | 124671488 |
| Molecular Formula | C18H34O6Si2 |
| Molecular Weight | 402.64 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | trimethoxy-[(1S)-1-[3-[(1S)-1-trimethoxysilylpropyl]phenyl]propyl]silane |
| SMILES | CC[C@@H](c1cccc([C@H](CC)[Si](OC)(OC)OC)c1)[Si](OC)(OC)OC |
| InChI | InChI=1S/C18H34O6Si2/c1-9-17(25(19-3,20-4)21-5)15-12-11-13-16(14-15)18(10-2)26(22-6,23-7)24-8/h11-14,17-18H,9-10H2,1-8H3/t17-,18-/m0/s1 |
| InChIKey | QBJCTMPFQNLSMC-ROUUACIJSA-N |
| XLogP | 3.51 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.64 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|