C12H13Cl2NO2 — CID 124675449
(3S,4S)-4-(2,4-dichlorophenyl)-1-methylpyrrolidine-3-carboxylic acid (PubChem CID 124675449) has the molecular formula C12H13Cl2NO2 and a molecular weight of 274.15 g/mol. Its IUPAC name is (3S,4S)-4-(2,4-dichlorophenyl)-1-methylpyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-4-(2,4-dichlorophenyl)-1-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 124675449 |
| Molecular Formula | C12H13Cl2NO2 |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | (3S,4S)-4-(2,4-dichlorophenyl)-1-methylpyrrolidine-3-carboxylic acid |
| SMILES | CN1C[C@H](c2ccc(Cl)cc2Cl)[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C12H13Cl2NO2/c1-15-5-9(10(6-15)12(16)17)8-3-2-7(13)4-11(8)14/h2-4,9-10H,5-6H2,1H3,(H,16,17)/t9-,10-/m1/s1 |
| InChIKey | YJEASCFQASAFMW-NXEZZACHSA-N |
| XLogP | 2.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |