C12H16ClNO — CID 124675472
[(3R,4S)-4-(4-chlorophenyl)-1-methylpyrrolidin-3-yl]methanol (PubChem CID 124675472) has the molecular formula C12H16ClNO and a molecular weight of 225.72 g/mol. Its IUPAC name is [(3R,4S)-4-(4-chlorophenyl)-1-methylpyrrolidin-3-yl]methanol.
| Compound Name | [(3R,4S)-4-(4-chlorophenyl)-1-methylpyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 124675472 |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | [(3R,4S)-4-(4-chlorophenyl)-1-methylpyrrolidin-3-yl]methanol |
| SMILES | CN1C[C@H](CO)[C@@H](c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C12H16ClNO/c1-14-6-10(8-15)12(7-14)9-2-4-11(13)5-3-9/h2-5,10,12,15H,6-8H2,1H3/t10-,12-/m1/s1 |
| InChIKey | YERUOLXDZSNEDO-ZYHUDNBSSA-N |
| XLogP | 1.98 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |