C14H21N3 — CID 124675823
(4aS,7aS)-6-benzyl-4-methyl-2,3,4a,5,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyrazine (PubChem CID 124675823) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is (4aS,7aS)-6-benzyl-4-methyl-2,3,4a,5,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyrazine.
| Compound Name | (4aS,7aS)-6-benzyl-4-methyl-2,3,4a,5,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyrazine |
|---|---|
| PubChem CID | 124675823 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | (4aS,7aS)-6-benzyl-4-methyl-2,3,4a,5,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyrazine |
| SMILES | CN1CCN[C@H]2CN(Cc3ccccc3)C[C@@H]21 |
| InChI | InChI=1S/C14H21N3/c1-16-8-7-15-13-10-17(11-14(13)16)9-12-5-3-2-4-6-12/h2-6,13-15H,7-11H2,1H3/t13-,14-/m0/s1 |
| InChIKey | FLDYGUQYUAEDOJ-KBPBESRZSA-N |
| XLogP | 0.77 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |