C16H25N3 — CID 83920112
2-(5-benzyl-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-3-yl)ethanamine (PubChem CID 83920112) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is 2-(5-benzyl-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-3-yl)ethanamine.
| Compound Name | 2-(5-benzyl-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-3-yl)ethanamine |
|---|---|
| PubChem CID | 83920112 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 2-(5-benzyl-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-3-yl)ethanamine |
| SMILES | CN1CC(CCN)C2CN(Cc3ccccc3)CC21 |
| InChI | InChI=1S/C16H25N3/c1-18-10-14(7-8-17)15-11-19(12-16(15)18)9-13-5-3-2-4-6-13/h2-6,14-16H,7-12,17H2,1H3 |
| InChIKey | NXZYBPZQOZOJGZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |