About 2-[[(3S,4S)-4-phenylpyrrolidin-3-yl]methyl]-4-(trifluoromethyl)pyridine
2-[[(3S,4S)-4-phenylpyrrolidin-3-yl]methyl]-4-(trifluoromethyl)pyridine (PubChem CID 124677140) has the molecular formula C17H17F3N2
and a molecular weight of 306.33 g/mol. Its IUPAC name is 2-[[(3S,4S)-4-phenylpyrrolidin-3-yl]methyl]-4-(trifluoromethyl)pyridine.
Molecular Properties
| Compound Name | 2-[[(3S,4S)-4-phenylpyrrolidin-3-yl]methyl]-4-(trifluoromethyl)pyridine |
| PubChem CID | 124677140 |
| Molecular Formula | C17H17F3N2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 2-[[(3S,4S)-4-phenylpyrrolidin-3-yl]methyl]-4-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1ccnc(C[C@@H]2CNC[C@@H]2c2ccccc2)c1 |
| InChI | InChI=1S/C17H17F3N2/c18-17(19,20)14-6-7-22-15(9-14)8-13-10-21-11-16(13)12-4-2-1-3-5-12/h1-7,9,13,16,21H,8,10-11H2/t13-,16-/m1/s1 |
| InChIKey | NNVOPQCGOLUTSQ-CZUORRHYSA-N |
| XLogP | 3.65 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[[(3S,4S)-4-phenylpyrrolidin-3-yl]methyl]-4-(trifluoromethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3S,4S)-4-phenylpyrrolidin-3-yl]methyl]-4-(trifluoromethyl)pyridine?
The IUPAC name of 2-[[(3S,4S)-4-phenylpyrrolidin-3-yl]methyl]-4-(trifluoromethyl)pyridine (CID 124677140) is 2-[[(3S,4S)-4-phenylpyrrolidin-3-yl]methyl]-4-(trifluoromethyl)pyridine.
What is the SMILES notation for 2-[[(3S,4S)-4-phenylpyrrolidin-3-yl]methyl]-4-(trifluoromethyl)pyridine?
The canonical SMILES for 2-[[(3S,4S)-4-phenylpyrrolidin-3-yl]methyl]-4-(trifluoromethyl)pyridine is FC(F)(F)c1ccnc(C[C@@H]2CNC[C@@H]2c2ccccc2)c1.
What is the InChIKey of 2-[[(3S,4S)-4-phenylpyrrolidin-3-yl]methyl]-4-(trifluoromethyl)pyridine?
The InChIKey is NNVOPQCGOLUTSQ-CZUORRHYSA-N. The full InChI is InChI=1S/C17H17F3N2/c18-17(19,20)14-6-7-22-15(9-14)8-13-10-21-11-16(13)12-4-2-1-3-5-12/h1-7,9,13,16,21H,8,10-11H2/t13-,16-/m1/s1.
What are the key properties of 2-[[(3S,4S)-4-phenylpyrrolidin-3-yl]methyl]-4-(trifluoromethyl)pyridine?
2-[[(3S,4S)-4-phenylpyrrolidin-3-yl]methyl]-4-(trifluoromethyl)pyridine has a molecular weight of 306.33 g/mol, XLogP of 3.65, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3S,4S)-4-phenylpyrrolidin-3-yl]methyl]-4-(trifluoromethyl)pyridine is sourced from PubChem (CID 124677140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).