C28H25N — CID 124678095
(3aS,4R,9bR)-4-anthracen-9-yl-7,9-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 124678095) has the molecular formula C28H25N and a molecular weight of 375.52 g/mol. Its IUPAC name is (3aS,4R,9bR)-4-anthracen-9-yl-7,9-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4R,9bR)-4-anthracen-9-yl-7,9-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 124678095 |
| Molecular Formula | C28H25N |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | (3aS,4R,9bR)-4-anthracen-9-yl-7,9-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Cc1cc(C)c2c(c1)N[C@@H](c1c3ccccc3cc3ccccc13)[C@H]1CC=C[C@@H]21 |
| InChI | InChI=1S/C28H25N/c1-17-14-18(2)26-23-12-7-13-24(23)28(29-25(26)15-17)27-21-10-5-3-8-19(21)16-20-9-4-6-11-22(20)27/h3-12,14-16,23-24,28-29H,13H2,1-2H3/t23-,24+,28-/m1/s1 |
| InChIKey | XSGFCFJOCFCKHI-FMGHJNRGSA-N |
| XLogP | 7.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|