C24H23N — CID 124677727
(3aS,4R,9bR)-7,9-dimethyl-4-naphthalen-1-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 124677727) has the molecular formula C24H23N and a molecular weight of 325.46 g/mol. Its IUPAC name is (3aS,4R,9bR)-7,9-dimethyl-4-naphthalen-1-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4R,9bR)-7,9-dimethyl-4-naphthalen-1-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 124677727 |
| Molecular Formula | C24H23N |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | (3aS,4R,9bR)-7,9-dimethyl-4-naphthalen-1-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Cc1cc(C)c2c(c1)N[C@@H](c1cccc3ccccc13)[C@H]1CC=C[C@@H]21 |
| InChI | InChI=1S/C24H23N/c1-15-13-16(2)23-19-10-6-12-21(19)24(25-22(23)14-15)20-11-5-8-17-7-3-4-9-18(17)20/h3-11,13-14,19,21,24-25H,12H2,1-2H3/t19-,21+,24+/m1/s1 |
| InChIKey | AVYKCLXYUZMRCC-IZIIKQMZSA-N |
| XLogP | 6.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|