C23H20ClN — CID 126171414
(3aR,4S,9bR)-8-chloro-6-methyl-4-naphthalen-1-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126171414) has the molecular formula C23H20ClN and a molecular weight of 345.87 g/mol. Its IUPAC name is (3aR,4S,9bR)-8-chloro-6-methyl-4-naphthalen-1-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aR,4S,9bR)-8-chloro-6-methyl-4-naphthalen-1-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126171414 |
| Molecular Formula | C23H20ClN |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | (3aR,4S,9bR)-8-chloro-6-methyl-4-naphthalen-1-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Cc1cc(Cl)cc2c1N[C@H](c1cccc3ccccc13)[C@@H]1CC=C[C@@H]21 |
| InChI | InChI=1S/C23H20ClN/c1-14-12-16(24)13-21-18-9-5-11-20(18)23(25-22(14)21)19-10-4-7-15-6-2-3-8-17(15)19/h2-10,12-13,18,20,23,25H,11H2,1H3/t18-,20-,23-/m1/s1 |
| InChIKey | SZBBPTVFVLCXGA-KKLQWCBXSA-N |
| XLogP | 6.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|