C29H22ClNO — CID 26475658
[(3aR,4S,9bR)-8-chloro-4-naphthalen-1-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]-phenylmethanone (PubChem CID 26475658) has the molecular formula C29H22ClNO and a molecular weight of 435.95 g/mol. Its IUPAC name is [(3aR,4S,9bR)-8-chloro-4-naphthalen-1-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]-phenylmethanone.
| Compound Name | [(3aR,4S,9bR)-8-chloro-4-naphthalen-1-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]-phenylmethanone |
|---|---|
| PubChem CID | 26475658 |
| Molecular Formula | C29H22ClNO |
| Molecular Weight | 435.95 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | [(3aR,4S,9bR)-8-chloro-4-naphthalen-1-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1cc(Cl)cc2c1N[C@H](c1cccc3ccccc13)[C@@H]1CC=C[C@@H]21 |
| InChI | InChI=1S/C29H22ClNO/c30-20-16-25-22-13-7-15-24(22)27(23-14-6-11-18-8-4-5-12-21(18)23)31-28(25)26(17-20)29(32)19-9-2-1-3-10-19/h1-14,16-17,22,24,27,31H,15H2/t22-,24-,27-/m1/s1 |
| InChIKey | NHXADBBAVOJIAK-LSCGWGKXSA-N |
| XLogP | 7.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.95 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|