C25H19ClFNO — CID 7273833
[(3aS,4S,9bR)-8-chloro-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]-phenylmethanone (PubChem CID 7273833) has the molecular formula C25H19ClFNO and a molecular weight of 403.88 g/mol. Its IUPAC name is [(3aS,4S,9bR)-8-chloro-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]-phenylmethanone.
| Compound Name | [(3aS,4S,9bR)-8-chloro-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]-phenylmethanone |
|---|---|
| PubChem CID | 7273833 |
| Molecular Formula | C25H19ClFNO |
| Molecular Weight | 403.88 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | [(3aS,4S,9bR)-8-chloro-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1cc(Cl)cc2c1N[C@H](c1ccc(F)cc1)[C@H]1CC=C[C@@H]21 |
| InChI | InChI=1S/C25H19ClFNO/c26-17-13-21-19-7-4-8-20(19)23(15-9-11-18(27)12-10-15)28-24(21)22(14-17)25(29)16-5-2-1-3-6-16/h1-7,9-14,19-20,23,28H,8H2/t19-,20+,23-/m1/s1 |
| InChIKey | HWTRKWRLQBDHNK-ZRCGQRJVSA-N |
| XLogP | 6.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.88 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|