C22H17Cl2N — CID 11887897
(3aR,4S,9bS)-6,8-dichloro-4-naphthalen-1-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 11887897) has the molecular formula C22H17Cl2N and a molecular weight of 366.29 g/mol. Its IUPAC name is (3aR,4S,9bS)-6,8-dichloro-4-naphthalen-1-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aR,4S,9bS)-6,8-dichloro-4-naphthalen-1-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 11887897 |
| Molecular Formula | C22H17Cl2N |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | (3aR,4S,9bS)-6,8-dichloro-4-naphthalen-1-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Clc1cc(Cl)c2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1cccc3ccccc13)N2 |
| InChI | InChI=1S/C22H17Cl2N/c23-14-11-19-16-8-4-10-18(16)21(25-22(19)20(24)12-14)17-9-3-6-13-5-1-2-7-15(13)17/h1-9,11-12,16,18,21,25H,10H2/t16-,18+,21+/m0/s1 |
| InChIKey | AKQYZGHKHSPZIM-YRISNDGFSA-N |
| XLogP | 6.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|