C27H37N3O4S — CID 124680166
(3S)-1-(4-methoxy-2,3-dimethylphenyl)sulfonyl-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]-2,3-dihydroindole-3-carboxamide (PubChem CID 124680166) has the molecular formula C27H37N3O4S and a molecular weight of 499.68 g/mol. Its IUPAC name is (3S)-1-(4-methoxy-2,3-dimethylphenyl)sulfonyl-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]-2,3-dihydroindole-3-carboxamide.
| Compound Name | (3S)-1-(4-methoxy-2,3-dimethylphenyl)sulfonyl-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]-2,3-dihydroindole-3-carboxamide |
|---|---|
| PubChem CID | 124680166 |
| Molecular Formula | C27H37N3O4S |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | (3S)-1-(4-methoxy-2,3-dimethylphenyl)sulfonyl-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]-2,3-dihydroindole-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2C[C@@H](C(=O)NCCCN3CCCC[C@@H]3C)c3ccccc32)c(C)c1C |
| InChI | InChI=1S/C27H37N3O4S/c1-19-10-7-8-16-29(19)17-9-15-28-27(31)23-18-30(24-12-6-5-11-22(23)24)35(32,33)26-14-13-25(34-4)20(2)21(26)3/h5-6,11-14,19,23H,7-10,15-18H2,1-4H3,(H,28,31)/t19-,23+/m0/s1 |
| InChIKey | GHACYOPTHMIAQJ-WMZHIEFXSA-N |
| XLogP | 3.99 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|