C29H35N3O4S — CID 91141326
1-(4-methoxynaphthalen-1-yl)sulfonyl-N-[3-(2-methylpiperidin-1-yl)propyl]-2,3-dihydroindole-3-carboxamide (PubChem CID 91141326) has the molecular formula C29H35N3O4S and a molecular weight of 521.68 g/mol. Its IUPAC name is 1-(4-methoxynaphthalen-1-yl)sulfonyl-N-[3-(2-methylpiperidin-1-yl)propyl]-2,3-dihydroindole-3-carboxamide.
| Compound Name | 1-(4-methoxynaphthalen-1-yl)sulfonyl-N-[3-(2-methylpiperidin-1-yl)propyl]-2,3-dihydroindole-3-carboxamide |
|---|---|
| PubChem CID | 91141326 |
| Molecular Formula | C29H35N3O4S |
| Molecular Weight | 521.68 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | 1-(4-methoxynaphthalen-1-yl)sulfonyl-N-[3-(2-methylpiperidin-1-yl)propyl]-2,3-dihydroindole-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CC(C(=O)NCCCN3CCCCC3C)c3ccccc32)c2ccccc12 |
| InChI | InChI=1S/C29H35N3O4S/c1-21-10-7-8-18-31(21)19-9-17-30-29(33)25-20-32(26-14-6-5-11-22(25)26)37(34,35)28-16-15-27(36-2)23-12-3-4-13-24(23)28/h3-6,11-16,21,25H,7-10,17-20H2,1-2H3,(H,30,33) |
| InChIKey | VTTNUYCYJMLRFC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.68 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|