About 2-fluoro-6-[[(2S)-2-(1,3-thiazol-2-yl)propyl]amino]benzonitrile
2-fluoro-6-[[(2S)-2-(1,3-thiazol-2-yl)propyl]amino]benzonitrile (PubChem CID 124680392) has the molecular formula C13H12FN3S
and a molecular weight of 261.33 g/mol. Its IUPAC name is 2-fluoro-6-[[(2S)-2-(1,3-thiazol-2-yl)propyl]amino]benzonitrile.
Molecular Properties
| Compound Name | 2-fluoro-6-[[(2S)-2-(1,3-thiazol-2-yl)propyl]amino]benzonitrile |
| PubChem CID | 124680392 |
| Molecular Formula | C13H12FN3S |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 2-fluoro-6-[[(2S)-2-(1,3-thiazol-2-yl)propyl]amino]benzonitrile |
| SMILES | C[C@@H](CNc1cccc(F)c1C#N)c1nccs1 |
| InChI | InChI=1S/C13H12FN3S/c1-9(13-16-5-6-18-13)8-17-12-4-2-3-11(14)10(12)7-15/h2-6,9,17H,8H2,1H3/t9-/m0/s1 |
| InChIKey | IGYUFERVYBOHNW-VIFPVBQESA-N |
| XLogP | 3.37 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-fluoro-6-[[(2S)-2-(1,3-thiazol-2-yl)propyl]amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-6-[[(2S)-2-(1,3-thiazol-2-yl)propyl]amino]benzonitrile?
The IUPAC name of 2-fluoro-6-[[(2S)-2-(1,3-thiazol-2-yl)propyl]amino]benzonitrile (CID 124680392) is 2-fluoro-6-[[(2S)-2-(1,3-thiazol-2-yl)propyl]amino]benzonitrile.
What is the SMILES notation for 2-fluoro-6-[[(2S)-2-(1,3-thiazol-2-yl)propyl]amino]benzonitrile?
The canonical SMILES for 2-fluoro-6-[[(2S)-2-(1,3-thiazol-2-yl)propyl]amino]benzonitrile is C[C@@H](CNc1cccc(F)c1C#N)c1nccs1.
What is the InChIKey of 2-fluoro-6-[[(2S)-2-(1,3-thiazol-2-yl)propyl]amino]benzonitrile?
The InChIKey is IGYUFERVYBOHNW-VIFPVBQESA-N. The full InChI is InChI=1S/C13H12FN3S/c1-9(13-16-5-6-18-13)8-17-12-4-2-3-11(14)10(12)7-15/h2-6,9,17H,8H2,1H3/t9-/m0/s1.
What are the key properties of 2-fluoro-6-[[(2S)-2-(1,3-thiazol-2-yl)propyl]amino]benzonitrile?
2-fluoro-6-[[(2S)-2-(1,3-thiazol-2-yl)propyl]amino]benzonitrile has a molecular weight of 261.33 g/mol, XLogP of 3.37, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-6-[[(2S)-2-(1,3-thiazol-2-yl)propyl]amino]benzonitrile is sourced from PubChem (CID 124680392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).