C16H24N2OS — CID 124681039
N-benzyl-2-[[(1R,2S)-2-ethylsulfanylcyclopentyl]amino]acetamide (PubChem CID 124681039) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is N-benzyl-2-[[(1R,2S)-2-ethylsulfanylcyclopentyl]amino]acetamide.
| Compound Name | N-benzyl-2-[[(1R,2S)-2-ethylsulfanylcyclopentyl]amino]acetamide |
|---|---|
| PubChem CID | 124681039 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N-benzyl-2-[[(1R,2S)-2-ethylsulfanylcyclopentyl]amino]acetamide |
| SMILES | CCS[C@H]1CCC[C@H]1NCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C16H24N2OS/c1-2-20-15-10-6-9-14(15)17-12-16(19)18-11-13-7-4-3-5-8-13/h3-5,7-8,14-15,17H,2,6,9-12H2,1H3,(H,18,19)/t14-,15+/m1/s1 |
| InChIKey | SLAACSBZTKIVHG-CABCVRRESA-N |
| XLogP | 2.57 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |