C14H19NO2S — CID 114121676
2-[(2-ethylsulfanylcyclopentyl)amino]benzoic acid (PubChem CID 114121676) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is 2-[(2-ethylsulfanylcyclopentyl)amino]benzoic acid.
| Compound Name | 2-[(2-ethylsulfanylcyclopentyl)amino]benzoic acid |
|---|---|
| PubChem CID | 114121676 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2-[(2-ethylsulfanylcyclopentyl)amino]benzoic acid |
| SMILES | CCSC1CCCC1Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C14H19NO2S/c1-2-18-13-9-5-8-12(13)15-11-7-4-3-6-10(11)14(16)17/h3-4,6-7,12-13,15H,2,5,8-9H2,1H3,(H,16,17) |
| InChIKey | XSBYAPNETUQKIX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |