C17H22N2O4S — CID 124682007
(2S,3aS,7aS)-1-[5-(acetamidomethyl)thiophene-2-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 124682007) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is (2S,3aS,7aS)-1-[5-(acetamidomethyl)thiophene-2-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | (2S,3aS,7aS)-1-[5-(acetamidomethyl)thiophene-2-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 124682007 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (2S,3aS,7aS)-1-[5-(acetamidomethyl)thiophene-2-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | CC(=O)NCc1ccc(C(=O)N2[C@H](C(=O)O)C[C@@H]3CCCC[C@@H]32)s1 |
| InChI | InChI=1S/C17H22N2O4S/c1-10(20)18-9-12-6-7-15(24-12)16(21)19-13-5-3-2-4-11(13)8-14(19)17(22)23/h6-7,11,13-14H,2-5,8-9H2,1H3,(H,18,20)(H,22,23)/t11-,13-,14-/m0/s1 |
| InChIKey | VJYHELJQBMSTDA-UBHSHLNASA-N |
| XLogP | 2.24 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |