C18H23NO3S — CID 119169383
1-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 119169383) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is 1-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | 1-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 119169383 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 1-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | O=C(O)C1CC2CCCCC2N1C(=O)c1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C18H23NO3S/c20-17(16-10-12-6-2-4-8-15(12)23-16)19-13-7-3-1-5-11(13)9-14(19)18(21)22/h10-11,13-14H,1-9H2,(H,21,22) |
| InChIKey | PZLJNDFTEZWCPV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |