C11H15NO5 — CID 124734197
(2S,3aS,7aS)-1-oxalo-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 124734197) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is (2S,3aS,7aS)-1-oxalo-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | (2S,3aS,7aS)-1-oxalo-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 124734197 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | (2S,3aS,7aS)-1-oxalo-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | O=C(O)C(=O)N1[C@H](C(=O)O)C[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C11H15NO5/c13-9(11(16)17)12-7-4-2-1-3-6(7)5-8(12)10(14)15/h6-8H,1-5H2,(H,14,15)(H,16,17)/t6-,7-,8-/m0/s1 |
| InChIKey | LZANCMICLZHXIB-FXQIFTODSA-N |
| XLogP | 0.32 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|